Decanoic acid 2-phenyl-1,3-dioxan-5-yl ester structure
|
Common Name | Decanoic acid 2-phenyl-1,3-dioxan-5-yl ester | ||
|---|---|---|---|---|
| CAS Number | 56630-72-9 | Molecular Weight | 334.45000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-phenyl-1,3-dioxan-5-yl) decanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H30O4 |
|---|---|
| Molecular Weight | 334.45000 |
| Exact Mass | 334.21400 |
| PSA | 44.76000 |
| LogP | 4.78450 |
| InChIKey | HUWPKIADWBKLFA-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OC1COC(c2ccccc2)OC1 |
|
~%
Decanoic acid 2... CAS#:56630-72-9 |
| Literature: Stimmel; King Journal of the American Chemical Society, 1934 , vol. 56, p. 1725 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Phenyl-1,3-dioxan-5-yl decanoate |
| Decanoic acid,2-phenyl-1,3-dioxan-5-yl ester |