duroquinol structure
|
Common Name | duroquinol | ||
|---|---|---|---|---|
| CAS Number | 5664-09-5 | Molecular Weight | 341.21200 | |
| Density | 1.048g/cm3 | Boiling Point | 294.1ºC at 760 mmHg | |
| Molecular Formula | C14H10Cl2N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,5-dichlorophenyl)sulfonyl-2-methylbenzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.048g/cm3 |
|---|---|
| Boiling Point | 294.1ºC at 760 mmHg |
| Molecular Formula | C14H10Cl2N2O2S |
| Molecular Weight | 341.21200 |
| Exact Mass | 339.98400 |
| PSA | 60.34000 |
| LogP | 4.96930 |
| Index of Refraction | 1.51 |
| InChIKey | RMVJRVKBWWOYPN-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C(O)C(C)=C(C)C1=O |
|
~%
duroquinol CAS#:5664-09-5 |
| Literature: Rudenko, A. P. Russian Journal of Organic Chemistry, 1994 , vol. 30, # 12 p. 1946 - 1980 Zhurnal Organicheskoi Khimii, 1994 , vol. 30, # 12 p. 1847 - 1881 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Durosemichinon-Kation |