spiro[adamantane-2,4'-oxazolidine]-2',5'-dione structure
|
Common Name | spiro[adamantane-2,4'-oxazolidine]-2',5'-dione | ||
|---|---|---|---|---|
| CAS Number | 56643-65-3 | Molecular Weight | 221.25200 | |
| Density | 1.35g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | spiro[adamantane-2,4'-oxazolidine]-2',5'-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25200 |
| Exact Mass | 221.10500 |
| PSA | 55.40000 |
| LogP | 1.77650 |
| Index of Refraction | 1.59 |
| InChIKey | ZIWNDVYCNBZXQE-UHFFFAOYSA-N |
| SMILES | O=C1NC2(C(=O)O1)C1CC3CC(C1)CC2C3 |
|
~%
spiro[adamantan... CAS#:56643-65-3 |
| Literature: Nagasawa; Elberling; Shirota Journal of Medicinal Chemistry, 1975 , vol. 18, # 8 p. 826 - 830 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-Carboxy-adamantanine anhydride |