5-oxo-L-proline, compound with (8α,9R)-6'-methoxycinchonan-9-ol (1:1)
Modify Date: 2025-10-03 08:42:02
5-oxo-L-proline, compound with (8α,9R)-6'-methoxycinchonan-9-ol (1:1) structure
|
Common Name | 5-oxo-L-proline, compound with (8α,9R)-6'-methoxycinchonan-9-ol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 56652-31-4 | Molecular Weight | 453.53100 | |
| Density | N/A | Boiling Point | 495.9ºC at 760 mmHg | |
| Molecular Formula | C25H31N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.7ºC | |
| Name | (R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol,(2S)-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 495.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.53100 |
| Flash Point | 253.7ºC |
| Exact Mass | 453.22600 |
| PSA | 115.48000 |
| LogP | 2.73660 |
| InChIKey | HYAFWGYUMDFMRG-FMOUBYBUSA-N |
| SMILES | C=CC1CN2CCC1CC2C(O)c1ccnc2ccc(OC)cc12.O=C1CCC(C(=O)O)N1 |
| einecs 260-311-4 |