3-amino-5-nitro-1H-pyridin-2-one structure
|
Common Name | 3-amino-5-nitro-1H-pyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 5667-38-9 | Molecular Weight | 155.11100 | |
| Density | 1.38g/cm3 | Boiling Point | 609.6ºC at 760mmHg | |
| Molecular Formula | C5H5N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.4ºC | |
| Name | 3-amino-5-nitro-1H-pyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 609.6ºC at 760mmHg |
| Molecular Formula | C5H5N3O3 |
| Molecular Weight | 155.11100 |
| Flash Point | 322.4ºC |
| Exact Mass | 155.03300 |
| PSA | 104.96000 |
| LogP | 1.38200 |
| Index of Refraction | 1.625 |
| InChIKey | WUMXEXOQVKMRQX-UHFFFAOYSA-N |
| SMILES | Nc1cc([N+](=O)[O-])c[nH]c1=O |
| HS Code | 2933399090 |
|---|
|
~%
3-amino-5-nitro... CAS#:5667-38-9 |
| Literature: US4038396 A1, ; |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Nitro-3-amino-2-hydroxy-pyridin |
| 2-HYDROXY-3-AMINO-5-NITROPYRIDINE |
| 3-amino-5-nitropyridin-2-ol |
| 3-Amino-5-nitropyridin-2(1H)-one |
| 3-Amino-2-hydroxy-5-nitropyridine |
| 5-Nitro-2-hydroxy-3-amino-pyridin |
| 3-Amino-2-hydroxy-5-nitro-pyridin |