3-(3-methoxyphenyl)-2-sulfanylidene-thiazolidin-4-one structure
|
Common Name | 3-(3-methoxyphenyl)-2-sulfanylidene-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 56676-53-0 | Molecular Weight | 239.31400 | |
| Density | 1.44g/cm3 | Boiling Point | 378.2ºC at 760 mmHg | |
| Molecular Formula | C10H9NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.5ºC | |
| Name | 3-(3-methoxyphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 378.2ºC at 760 mmHg |
| Molecular Formula | C10H9NO2S2 |
| Molecular Weight | 239.31400 |
| Flash Point | 182.5ºC |
| Exact Mass | 239.00700 |
| PSA | 86.93000 |
| LogP | 2.12490 |
| Index of Refraction | 1.699 |
| InChIKey | RREGYXSCJUSZCE-UHFFFAOYSA-N |
| SMILES | COc1cccc(N2C(=O)CSC2=S)c1 |
|
~69%
3-(3-methoxyphe... CAS#:56676-53-0 |
| Literature: He, Xiao-Yang; Zou, Peng; Qiu, Jiayin; Hou, Ling; Jiang, Shibo; Liu, Shuwen; Xie, Lan Bioorganic and Medicinal Chemistry, 2011 , vol. 19, # 22 p. 6726 - 6734 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(3-Methoxy-phenyl)-2-thioxo-thiazolidin-4-on |
| 3-(3-methoxyphenyl)-2-thioxo-1,3-thiazolidin-4-one |
| 4-thiazolidinone,3-(3-methoxyphenyl)-2-thioxo |
| 3-(3-methoxy-phenyl)-2-thioxo-thiazolidin-4-one |