2-Methyl-3-nitrobenzene-1-sulfonyl chloride structure
|
Common Name | 2-Methyl-3-nitrobenzene-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 56682-04-3 | Molecular Weight | 235.64500 | |
| Density | 1.528g/cm3 | Boiling Point | 348.503ºC at 760 mmHg | |
| Molecular Formula | C7H6ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.569ºC | |
| Name | 2-methyl-3-nitrobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.528g/cm3 |
|---|---|
| Boiling Point | 348.503ºC at 760 mmHg |
| Molecular Formula | C7H6ClNO4S |
| Molecular Weight | 235.64500 |
| Flash Point | 164.569ºC |
| Exact Mass | 234.97100 |
| PSA | 88.34000 |
| LogP | 3.43470 |
| Index of Refraction | 1.576 |
| InChIKey | SQIRQSKPXILWAM-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])cccc1S(=O)(=O)Cl |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Nitrotoluol-6-sulfonylchlorid |
| 2-methyl-3-nitro-benzenesulfonyl chloride |