TLR1 structure
|
Common Name | TLR1 | ||
|---|---|---|---|---|
| CAS Number | 566914-00-9 | Molecular Weight | 302.41100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TLR1TLR1 (compound 4a) is a low molecular weight, cell-penetrating Toll/IL-1 receptor/resistance (TIR) domain/BB-Loop mimic. TLR1 inhibits IL-1 receptor-mediated responses[1]. |
| Name | Benzenepropanamide, N-[(1S)-2-methyl-1-(1-pyrrolidinylcarbonyl)propyl] |
|---|
| Description | TLR1 (compound 4a) is a low molecular weight, cell-penetrating Toll/IL-1 receptor/resistance (TIR) domain/BB-Loop mimic. TLR1 inhibits IL-1 receptor-mediated responses[1]. |
|---|---|
| Related Catalog | |
| In Vitro | TLR1 inhibits IL-1β-induced phosphorylation of the mitogen-activated protein kinase p38 in EL4 thymoma cells and in freshly isolated murine lymphocytes in a concentration-dependent manner[1]. |
| In Vivo | TLR1 interferes with the interactions between mouse MyD88 and IL-1RI at the TIR domains. TLR1 produces a significant attenuation of the IL-1β-induced fever response (200 mg/kg, i.p.)[1]. |
| References |
| Molecular Formula | C18H26N2O2 |
|---|---|
| Molecular Weight | 302.41100 |
| Exact Mass | 302.19900 |
| PSA | 49.41000 |
| LogP | 2.71120 |
| InChIKey | DAZSWUUAFHBCGE-KRWDZBQOSA-N |
| SMILES | CC(C)C(NC(=O)CCc1ccccc1)C(=O)N1CCCC1 |