rosaprostol structure
|
Common Name | rosaprostol | ||
|---|---|---|---|---|
| CAS Number | 56695-65-9 | Molecular Weight | 298.46100 | |
| Density | 0.981g/cm3 | Boiling Point | 442.1ºC at 760 mmHg | |
| Molecular Formula | C18H34O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.3ºC | |
| Name | 7-(2-hexyl-5-hydroxycyclopentyl)heptanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 0.981g/cm3 |
|---|---|
| Boiling Point | 442.1ºC at 760 mmHg |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.46100 |
| Flash Point | 235.3ºC |
| Exact Mass | 298.25100 |
| PSA | 57.53000 |
| LogP | 4.76910 |
| Index of Refraction | 1.481 |
| InChIKey | NMAOJFAMEOVURT-GARXDOFDSA-N |
| SMILES | CCCCCCC1CCC(O)C1CCCCCCC(=O)O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Cyclopentaneheptanoic acid,2-hexyl-5-hydroxy |
| 7-(2-hexyl-5-hydroxy-cyclopentyl)-heptanoic acid |
| Rosaprostol |
| C-83 |
| Ibi-C83 |
| 9-hydroxy-19,20-bisnorprostanoic acid |
| 2-hexyl-5-hydroxycyclopentaneheptanoic acid |