N-[3-(4-Aminophenoxy)phenyl]-N,N-dimethylamine
Modify Date: 2025-09-18 10:09:57
![N-[3-(4-Aminophenoxy)phenyl]-N,N-dimethylamine Structure](https://image.chemsrc.com/caspic/320/56705-87-4.png)
N-[3-(4-Aminophenoxy)phenyl]-N,N-dimethylamine structure
|
Common Name | N-[3-(4-Aminophenoxy)phenyl]-N,N-dimethylamine | ||
|---|---|---|---|---|
| CAS Number | 56705-87-4 | Molecular Weight | 228.29000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[3-(4-Aminophenoxy)phenyl]-N,N-dimethylamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16N2O |
|---|---|
| Molecular Weight | 228.29000 |
| Exact Mass | 228.12600 |
| PSA | 38.49000 |
| LogP | 3.70830 |
| InChIKey | CIKCSTNDCHSSHE-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc(Oc2ccc(N)cc2)c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(4-aminophenoxy)-N,N-dimethylaniline |