1-cyclohexyl-5-phenyl-3,3-bis(prop-2-enyl)piperidine-2,4,6-trione structure
|
Common Name | 1-cyclohexyl-5-phenyl-3,3-bis(prop-2-enyl)piperidine-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 56714-17-1 | Molecular Weight | 365.46500 | |
| Density | 1.113g/cm3 | Boiling Point | 519.5ºC at 760 mmHg | |
| Molecular Formula | C23H27NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.3ºC | |
| Name | 1-cyclohexyl-5-phenyl-3,3-bis(prop-2-enyl)piperidine-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 519.5ºC at 760 mmHg |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.46500 |
| Flash Point | 217.3ºC |
| Exact Mass | 365.19900 |
| PSA | 54.45000 |
| LogP | 4.11730 |
| Index of Refraction | 1.549 |
| InChIKey | DDWZWIOZOLOARS-UHFFFAOYSA-N |
| SMILES | C=CCC1(CC=C)C(=O)C(c2ccccc2)C(=O)N(C2CCCCC2)C1=O |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Cyclohexyl-2,2-diallyl-3-oxo-4-phenylglutarimide |
| 1-Cyclohexyl-3-phenyl-5,5-diallylpiperidine-2,4,6-trione |
| Glutarimide,N-cyclohexyl-2,2-diallyl-3-oxo-4-phenyl |
| 3,3-diallyl-1-cyclohexyl-5-phenyl-piperidine-2,4,6-trione |