1-cyclohexyl-3,3-diethylpiperidine-2,4,6-trione structure
|
Common Name | 1-cyclohexyl-3,3-diethylpiperidine-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 56714-18-2 | Molecular Weight | 265.34800 | |
| Density | 1.102g/cm3 | Boiling Point | 416.6ºC at 760 mmHg | |
| Molecular Formula | C15H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.2ºC | |
| Name | 1-cyclohexyl-3,3-diethylpiperidine-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.102g/cm3 |
|---|---|
| Boiling Point | 416.6ºC at 760 mmHg |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.34800 |
| Flash Point | 180.2ºC |
| Exact Mass | 265.16800 |
| PSA | 54.45000 |
| LogP | 2.39140 |
| Index of Refraction | 1.504 |
| InChIKey | DBBXIIGYVZWDBT-UHFFFAOYSA-N |
| SMILES | CCC1(CC)C(=O)CC(=O)N(C2CCCCC2)C1=O |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Glutarimide,N-cyclohexyl-2,2-diethyl-3-oxo |
| N-Cyclohexyl-2,2-diethyl-3-oxoglutarimide |
| 1-Cyclohexyl-5,5-diethylpiperidine-2,4,6-trione |
| 1-cyclohexyl-3,3-diethyl-piperidine-2,4,6-trione |