Carbonochloridic acid,C,C'-1,10-decanediyl ester
Carbonochloridic acid,C,C'-1,10-decanediyl ester structure
|
Common Name | Carbonochloridic acid,C,C'-1,10-decanediyl ester | ||
|---|---|---|---|---|
| CAS Number | 56757-75-6 | Molecular Weight | 299.19100 | |
| Density | 1.167g/cm3 | Boiling Point | 353.7ºC at 760 mmHg | |
| Molecular Formula | C12H20Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.8ºC | |
Summary: 10-Carbonochloridoyloxydecyl carbonochloridate (English name: 10-carbonochloridoyloxydecyl carbonochloridate, Common English name: Carbonochloridic acid,C,C'-1,10-decanediyl ester, CAS number: 56757-75-6, Molecular formula: C12H20Cl2O4, Molecular weight: 299.19100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 10-carbonochloridoyloxydecyl carbonochloridate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 353.7ºC at 760 mmHg |
| Molecular Formula | C12H20Cl2O4 |
| Molecular Weight | 299.19100 |
| Flash Point | 126.8ºC |
| Exact Mass | 298.07400 |
| PSA | 52.60000 |
| LogP | 4.85800 |
| Index of Refraction | 1.465 |
| InChIKey | PHSFDGSQPPVUFX-UHFFFAOYSA-N |
| SMILES | O=C(Cl)OCCCCCCCCCCOC(=O)Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Carbonochloridi... CAS#:56757-75-6 |
| Literature: Violleau; Thiebaud; Borredon; Le Gars Synthetic Communications, 2001 , vol. 31, # 3 p. 367 - 373 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:2162-98-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| decane-1,10-diyl dicarbonochloridate |
| 1,10-decamethylene glycol dichloroformate |
| Bis-chlorameisensaeure-decamethylenester |
| 1,10-Bis-chlorformyloxy-decan |
| 1,10-decanediol-bischloroformate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 10-carbonochloridoyloxydecyl carbonochloridate? |
| A: SMILES notation of 10-carbonochloridoyloxydecyl carbonochloridate is O=C(Cl)OCCCCCCCCCCOC(=O)Cl. |
| Q: What English synonyms does 10-carbonochloridoyloxydecyl carbonochloridate have? |
| A: English synonyms of 10-carbonochloridoyloxydecyl carbonochloridate: decane-1,10-diyl dicarbonochloridate, 1,10-decamethylene glycol dichloroformate, Bis-chlorameisensaeure-decamethylenester, 1,10-Bis-chlorformyloxy-decan, 1,10-decanediol-bischloroformate. |
| Q: What is the molecular weight of 10-carbonochloridoyloxydecyl carbonochloridate? |
| A: Molecular weight of 10-carbonochloridoyloxydecyl carbonochloridate is 299.19100. |
| Q: What is the Chinese name of 56757-75-6? |
| A: Chinese name of 56757-75-6 is 56757-75-6. |
| Q: What is the polar surface area (PSA) of 10-carbonochloridoyloxydecyl carbonochloridate? |
| A: Polar surface area (PSA) of 10-carbonochloridoyloxydecyl carbonochloridate is 52.60000. |
| Q: What is the LogP of 10-carbonochloridoyloxydecyl carbonochloridate? |
| A: LogP of 10-carbonochloridoyloxydecyl carbonochloridate is 4.85800. |
| Q: What is the English name of 10-carbonochloridoyloxydecyl carbonochloridate? |
| A: The English name of 10-carbonochloridoyloxydecyl carbonochloridate is 10-carbonochloridoyloxydecyl carbonochloridate. |
| Q: What is the InChIKey of 10-carbonochloridoyloxydecyl carbonochloridate? |
| A: InChIKey of 10-carbonochloridoyloxydecyl carbonochloridate is PHSFDGSQPPVUFX-UHFFFAOYSA-N. |
| Q: What is the CAS number of 10-carbonochloridoyloxydecyl carbonochloridate? |
| A: CAS number of 10-carbonochloridoyloxydecyl carbonochloridate is 56757-75-6. |
| Q: What is the molecular formula of 10-carbonochloridoyloxydecyl carbonochloridate? |
| A: Molecular formula of 10-carbonochloridoyloxydecyl carbonochloridate is C12H20Cl2O4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |