Ethanedioic acid,1,2-bis[2-(2,4-dichlorophenoxy)ethyl] ester structure
|
Common Name | Ethanedioic acid,1,2-bis[2-(2,4-dichlorophenoxy)ethyl] ester | ||
|---|---|---|---|---|
| CAS Number | 5676-21-1 | Molecular Weight | 468.11200 | |
| Density | 1.466g/cm3 | Boiling Point | 557.3ºC at 760mmHg | |
| Molecular Formula | C18H14Cl4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.6ºC | |
| Name | bis[2-(2,4-dichlorophenoxy)ethyl] oxalate |
|---|
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 557.3ºC at 760mmHg |
| Molecular Formula | C18H14Cl4O6 |
| Molecular Weight | 468.11200 |
| Flash Point | 199.6ºC |
| Exact Mass | 465.95400 |
| PSA | 71.06000 |
| LogP | 4.84440 |
| Index of Refraction | 1.575 |
| InChIKey | MNKHUKCJIICUQJ-UHFFFAOYSA-N |
| SMILES | O=C(OCCOc1ccc(Cl)cc1Cl)C(=O)OCCOc1ccc(Cl)cc1Cl |
| HS Code | 2918990090 |
|---|
|
~%
Ethanedioic aci... CAS#:5676-21-1 |
| Literature: Union Carbide and Carbon Corp. Patent: DE959067 , 1952 ; Full Text Show Details Union Carbide and Carbon Corp. Patent: US2765224 , 1951 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |