4-methyl-N-nitrobenzenesulfonamide structure
|
Common Name | 4-methyl-N-nitrobenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 56764-43-3 | Molecular Weight | 216.21400 | |
| Density | 1.417g/cm3 | Boiling Point | 380.3ºC at 760 mmHg | |
| Molecular Formula | C7H8N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.8ºC | |
| Name | 4-methyl-N-nitrobenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 380.3ºC at 760 mmHg |
| Molecular Formula | C7H8N2O4S |
| Molecular Weight | 216.21400 |
| Flash Point | 183.8ºC |
| Exact Mass | 216.02000 |
| PSA | 100.37000 |
| LogP | 2.45990 |
| Index of Refraction | 1.567 |
| InChIKey | XRBIVTYUKPDCMI-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N[N+](=O)[O-])cc1 |
| HS Code | 2935009090 |
|---|
|
~%
4-methyl-N-nitr... CAS#:56764-43-3 |
| Literature: Mathews Journal of Physical Chemistry, 1920 , vol. 24, p. 112,116 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N-nitro-toluene-4-sulfonamide |
| N-Nitro-p-toluenesulfonamide |
| N-Nitro-toluol-4-sulfonsaeureamid |
| N-Nitro-toluol-4-sulfonamid |
| Benzenesulfonamide,4-methyl-N-nitro |
| N-nitro-p-toluenesulfamide |
| p-Toluenesulfonamide,N-nitro |