ethyl (3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetate
Modify Date: 2025-08-24 19:38:11
ethyl (3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetate structure
|
Common Name | ethyl (3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 5679-18-5 | Molecular Weight | 227.21700 | |
| Density | 1.32g/cm3 | Boiling Point | 337.6ºC at 760 mmHg | |
| Molecular Formula | C9H13N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.9ºC | |
| Name | ethyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 337.6ºC at 760 mmHg |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.21700 |
| Flash Point | 157.9ºC |
| Exact Mass | 227.09100 |
| PSA | 89.94000 |
| LogP | 1.49440 |
| Index of Refraction | 1.566 |
| InChIKey | XQUYPKGOLQYZRE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cn1nc(C)c([N+](=O)[O-])c1C |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(3,4-dimethoxy-benzyl)-3-methyl-5,6-dihydro-cyclopenta[b]thiophen-4-one |
| 5-<3,4-Dimethoxy-benzyl>-3-methyl-5,6-dihydro-cyclopenta<b>thiophen-4-on |
| ethyl (3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetate |
| ethyl 2-(3,5-dimethyl-4-nitropyrazolyl)acetate |