N-isobutyl-3,5-dinitrobenzamide
Modify Date: 2025-09-19 16:47:02
N-isobutyl-3,5-dinitrobenzamide structure
|
Common Name | N-isobutyl-3,5-dinitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 56808-99-2 | Molecular Weight | 267.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-isobutyl-3,5-dinitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13N3O5 |
|---|---|
| Molecular Weight | 267.23800 |
| Exact Mass | 267.08600 |
| PSA | 120.74000 |
| LogP | 3.32610 |
| InChIKey | UMWOXYJRLFRVOH-UHFFFAOYSA-N |
| SMILES | CC(C)CNC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:10478-01-0|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
Total 3, Current Page 1 of 1
1
| 3,5-dinitro-benzoic acid isobutylamide |
| N-isobutyl 3,5-dinitrobenzamide |
| N-[3,5-Dinitro-benzoyl]-isobutylamin |
| 3,5-Dinitro-benzoesaeure-isobutylamid |
| N-[3.5-Dinitro-benzoyl]-isobutylamin |
| N-Isobutyl-3.5-dinitro-benzamid |