4-Phenanthrenecarboxylicacid, 5-formyl- structure
|
Common Name | 4-Phenanthrenecarboxylicacid, 5-formyl- | ||
|---|---|---|---|---|
| CAS Number | 5684-15-1 | Molecular Weight | 250.24900 | |
| Density | 1.376g/cm3 | Boiling Point | 532.2ºC at 760mmHg | |
| Molecular Formula | C16H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.7ºC | |
| Name | 5-formylphenanthrene-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.376g/cm3 |
|---|---|
| Boiling Point | 532.2ºC at 760mmHg |
| Molecular Formula | C16H10O3 |
| Molecular Weight | 250.24900 |
| Flash Point | 289.7ºC |
| Exact Mass | 250.06300 |
| PSA | 54.37000 |
| LogP | 3.50370 |
| Index of Refraction | 1.77 |
| InChIKey | WNGATLAAVNRKQO-UHFFFAOYSA-N |
| SMILES | O=Cc1cccc2ccc3cccc(C(=O)O)c3c12 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-formyl-5-phenanthroic acid |
| 5-Formyl-phenantrene-4-carboxylic acid |
| 5-formyl-phenanthrene-4-carboxylic acid |
| 5-Formyl-phenanthren-4-carbonsaeure |
| 4-Formyl-phenanthren-5-carbonsaeure |
| 4-carboxy-5-phenanthrenecarboxaldehyde |
| 5-formyl-4-phenanthrenecarboxylic acid |
| 5-FORMYL-4-PHENANTHROIC ACID |