1-methyl-3,3-diphenylpyrrolidine-2,5-dione structure
|
Common Name | 1-methyl-3,3-diphenylpyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 5685-20-1 | Molecular Weight | 265.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-3,3-diphenylpyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H15NO2 |
|---|---|
| Molecular Weight | 265.30700 |
| Exact Mass | 265.11000 |
| PSA | 37.38000 |
| LogP | 2.29930 |
| InChIKey | XAGDDMXCFDTALW-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC(c2ccccc2)(c2ccccc2)C1=O |
| HS Code | 2925190090 |
|---|
|
~%
1-methyl-3,3-di... CAS#:5685-20-1 |
| Literature: Miller; Long Journal of the American Chemical Society, 1951 , vol. 73, p. 4895,4897 |
|
~%
1-methyl-3,3-di... CAS#:5685-20-1 |
| Literature: Queen Chemistry and Industry (London, United Kingdom), 1958 , p. 196 |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,5-Pyrrolidinedione,1-methyl-3,3-diphenyl |
| 1-methyl-3,3-diphenyl-pyrrolidine-2,5-dione |
| 1-Methyl-3,3-diphenyl-pyrrolidin-2,5-dion |
| N-Methyl-2,2-diphenyl-succinimid |
| N-Methyl-diphenyl-3,3-succinimid |