1-phenyl-3-(2,4,6-trimethylphenyl)prop-2-yn-1-one structure
|
Common Name | 1-phenyl-3-(2,4,6-trimethylphenyl)prop-2-yn-1-one | ||
|---|---|---|---|---|
| CAS Number | 5689-92-9 | Molecular Weight | 248.31900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenyl-3-(2,4,6-trimethylphenyl)prop-2-yn-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H16O |
|---|---|
| Molecular Weight | 248.31900 |
| Exact Mass | 248.12000 |
| PSA | 17.07000 |
| LogP | 3.84620 |
| InChIKey | OFOHVAXIGPSYBJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(C#CC(=O)c2ccccc2)c(C)c1 |
| HS Code | 2914399090 |
|---|
|
~%
1-phenyl-3-(2,4... CAS#:5689-92-9 |
| Literature: Fuson; Ullyot; Hickson Journal of the American Chemical Society, 1939 , vol. 61, p. 410 |
|
~69%
1-phenyl-3-(2,4... CAS#:5689-92-9 |
| Literature: Vasilyev; Walspurger; Haouas; Sommer; Pale; Rudenko Organic and Biomolecular Chemistry, 2004 , vol. 2, # 23 p. 3483 - 3489 |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 3-mesityl-1-phenyl-propynone |
| <2,4,6-Trimethyl-phenyl>benzoyl-acetylen |
| 3-Mesityl-1-phenyl-propinon |