1-(2-(P-TOLYLOXY)ETHYL)HYDRAZINE
1-(2-(P-TOLYLOXY)ETHYL)HYDRAZINE structure
|
Common Name | 1-(2-(P-TOLYLOXY)ETHYL)HYDRAZINE | ||
|---|---|---|---|---|
| CAS Number | 569-72-2 | Molecular Weight | 234.21600 | |
| Density | 1.2g/cm3 | Boiling Point | 261.518ºC at 760 mmHg | |
| Molecular Formula | C14H9F3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 97.587ºC | |
Summary: 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene (Chinese name: 1-(2,2-二氟-1-苯基乙烯基)-4-氟苯，CAS number: 569-72-2)，molecular formula: C14H9F3，molecular weight: 234.21600，for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 261.518ºC at 760 mmHg |
| Molecular Formula | C14H9F3 |
| Molecular Weight | 234.21600 |
| Flash Point | 97.587ºC |
| Exact Mass | 234.06600 |
| LogP | 4.48160 |
| Index of Refraction | 1.534 |
| InChIKey | ANXOZOZWHNFHPZ-UHFFFAOYSA-N |
| SMILES | FC(F)=C(c1ccccc1)c1ccc(F)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 0 | |
CAS#:960-16-7
CAS#:591-50-4
CAS#:119-61-9![Bis[trifluoromethyl]mercury Structure](https://image.chemsrc.com/caspic/260/371-76-6.png)
CAS#:371-76-6
CAS#:116-14-3
CAS#:100-58-3
CAS#:5123-13-7
CAS#:1010720-48-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1-diphenyl-2,2-difluoroethene |
| 1,1-difluoro-2,2-diphenylethylene |
| (2,2-difluoroethene-1,1-diyl)dibenzene |
| 1-bromo-1-phenyl-2,2-difluoroethene |
| Benzene,1-(2,2-difluoro-1-phenylethenyl)-4-fluoro |
| (2,2-difluoroethenylidene)dibenzene |
| 1,1-difluoro-2,2-diphenyl-ethene |
| 1-(2,2-DIFLUORO-1-PHENYL-VINYL)-4-FLUORO-BENZENE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene? |
| A: CAS number of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene is 569-72-2. |
| Q: What is the LogP of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene? |
| A: LogP of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene is 4.48160. |
| Q: What is the molecular weight of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene? |
| A: Molecular weight of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene is 234.21600. |
| Q: What is the InChIKey of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene? |
| A: InChIKey of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene is ANXOZOZWHNFHPZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene? |
| A: Molecular formula of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene is C14H9F3. |
| Q: What is the English name of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene? |
| A: The English name of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene is 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene. |
| Q: What is the boiling point of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene? |
| A: Boiling point of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene is 261.518ºC at 760 mmHg. |
| Q: What is the SMILES notation of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene? |
| A: SMILES notation of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene is FC(F)=C(c1ccccc1)c1ccc(F)cc1. |
| Q: What are the upstream materials of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene? |
| A: Related upstream materials(CAS) of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene: 960-16-7;591-50-4;119-61-9;371-76-6;116-14-3;100-58-3;5123-13-7;1010720-48-5. |
| Q: What English synonyms does 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene have? |
| A: English synonyms of 1-(2,2-difluoro-1-phenylethenyl)-4-fluorobenzene: 1,1-diphenyl-2,2-difluoroethene, 1,1-difluoro-2,2-diphenylethylene, (2,2-difluoroethene-1,1-diyl)dibenzene, 1-bromo-1-phenyl-2,2-difluoroethene, Benzene,1-(2,2-difluoro-1-phenylethenyl)-4-fluoro, (2,2-difluoroethenylidene)dibenzene, 1,1-difluoro-2,2-diphenyl-ethene, 1-(2,2-DIFLUORO-1-PHENYL-VINYL)-4-FLUORO-BENZENE. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |