4-chlorotoluene-3-sulphonic acid structure
|
Common Name | 4-chlorotoluene-3-sulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 56919-12-1 | Molecular Weight | 206.64700 | |
| Density | 1.471g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H7ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-5-methylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.471g/cm3 |
|---|---|
| Molecular Formula | C7H7ClO3S |
| Molecular Weight | 206.64700 |
| Exact Mass | 205.98000 |
| PSA | 62.75000 |
| LogP | 2.97590 |
| Index of Refraction | 1.577 |
| InChIKey | ZZKWWRXVSXCBIU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)c(S(=O)(=O)O)c1 |
|
~%
4-chlorotoluene... CAS#:56919-12-1 |
| Literature: Cerfontain, Hans; Koeberg-Telder, Ankie; Laali, Khosrow; Lambrechts, Hans J. A.; Wit, Peter de Recueil: Journal of the Royal Netherlands Chemical Society, 1982 , vol. 101, # 11 p. 390 - 392 |
|
~%
4-chlorotoluene... CAS#:56919-12-1 |
| Literature: Wynne; Bruce Journal of the Chemical Society, 1898 , vol. 73, p. 754 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenesulfonic acid,2-chloro-5-methyl |
| 4-chloro-toluene-3-sulfonic acid |
| 4-Chlortoluol-3-sulfonsaeure |
| EINECS 260-434-3 |
| 4-Chlorotoluene-3-sulphonic acid |