propan-2-yl 5-[(3-chlorobenzoyl)amino]-4-cyano-3-methylthiophene-2-carboxylate
Modify Date: 2025-09-18 10:48:43
![propan-2-yl 5-[(3-chlorobenzoyl)amino]-4-cyano-3-methylthiophene-2-carboxylate Structure](https://image.chemsrc.com/caspic/400/5692-21-7.png)
propan-2-yl 5-[(3-chlorobenzoyl)amino]-4-cyano-3-methylthiophene-2-carboxylate structure
|
Common Name | propan-2-yl 5-[(3-chlorobenzoyl)amino]-4-cyano-3-methylthiophene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5692-21-7 | Molecular Weight | 362.83100 | |
| Density | 1.36g/cm3 | Boiling Point | 453.6ºC at 760 mmHg | |
| Molecular Formula | C17H15ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.1ºC | |
| Name | propan-2-yl 5-[(3-chlorobenzoyl)amino]-4-cyano-3-methylthiophene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 453.6ºC at 760 mmHg |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.83100 |
| Flash Point | 228.1ºC |
| Exact Mass | 362.04900 |
| PSA | 110.92000 |
| LogP | 4.78308 |
| Index of Refraction | 1.609 |
| InChIKey | VXFRDYHYZJTYAC-UHFFFAOYSA-N |
| SMILES | Cc1c(C(=O)OC(C)C)sc(NC(=O)c2cccc(Cl)c2)c1C#N |
| HS Code | 2925290090 |
|---|
|
~%
propan-2-yl 5-[... CAS#:5692-21-7 |
| Literature: Ueda; Okamoto; Tsuji; Muraoka Chemical and pharmaceutical bulletin, 1968 , vol. 16, # 12 p. 2355 - 2361 |
|
~%
propan-2-yl 5-[... CAS#:5692-21-7 |
| Literature: Ueda; Okamoto; Tsuji; Muraoka Chemical and pharmaceutical bulletin, 1968 , vol. 16, # 12 p. 2355 - 2361 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:5813-81-0| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| hippuramidine |
| 2-Benzoylaminoacetamidin |