5-bromo-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one structure
|
Common Name | 5-bromo-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 56921-39-2 | Molecular Weight | 302.21100 | |
| Density | 1.74g/cm3 | Boiling Point | 385.4ºC at 760 mmHg | |
| Molecular Formula | C10H8BrNOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.9ºC | |
| Name | 5-bromo-3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.74g/cm3 |
|---|---|
| Boiling Point | 385.4ºC at 760 mmHg |
| Molecular Formula | C10H8BrNOS2 |
| Molecular Weight | 302.21100 |
| Flash Point | 186.9ºC |
| Exact Mass | 300.92300 |
| PSA | 77.70000 |
| LogP | 3.14570 |
| Index of Refraction | 1.74 |
| InChIKey | KFRHCUCDSCFAAJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2C(=O)C(Br)SC2=S)cc1 |
|
~%
5-bromo-3-(4-me... CAS#:56921-39-2 |
| Literature: Pujari; Rout Journal of Scientific and Industrial Research, 1955 , vol. 14 B, p. 398 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-Brom-2-thioxo-3-p-tolyl-thiazolidin-4-on |
| 5-bromo-2-thioxo-3-p-tolyl-thiazolidin-4-one |
| 5-Bromo-3-p-tolylrhodanine |