3-tert-butyl-1,5-diphenylpenta-1,4-diyn-3-ol structure
|
Common Name | 3-tert-butyl-1,5-diphenylpenta-1,4-diyn-3-ol | ||
|---|---|---|---|---|
| CAS Number | 56922-99-7 | Molecular Weight | 288.38300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H20O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-tert-butyl-1,5-diphenylpenta-1,4-diyn-3-ol |
|---|
| Molecular Formula | C21H20O |
|---|---|
| Molecular Weight | 288.38300 |
| Exact Mass | 288.15100 |
| PSA | 20.23000 |
| LogP | 3.86700 |
| InChIKey | NOAGCXPYOUAWBM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(O)(C#Cc1ccccc1)C#Cc1ccccc1 |
|
~%
3-tert-butyl-1,... CAS#:56922-99-7 |
| Literature: Hauptmann,H.; Mader,M. Synthesis, 1978 , p. 307 - 309 |
|
~%
3-tert-butyl-1,... CAS#:56922-99-7 |
| Literature: Toda,F.; Takahara,Y. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 2515 - 2517 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |