methyl 2-hydroxy-5-(4-hydroxy-2-methoxy-5-methoxycarbonyl-phenyl)sulfonyl-4-methoxy-benzoate structure
|
Common Name | methyl 2-hydroxy-5-(4-hydroxy-2-methoxy-5-methoxycarbonyl-phenyl)sulfonyl-4-methoxy-benzoate | ||
|---|---|---|---|---|
| CAS Number | 56923-25-2 | Molecular Weight | 426.39500 | |
| Density | 1.428g/cm3 | Boiling Point | 672.1ºC at 760 mmHg | |
| Molecular Formula | C18H18O10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 360.3ºC | |
| Name | methyl 2-hydroxy-5-(4-hydroxy-2-methoxy-5-methoxycarbonylphenyl)sulfonyl-4-methoxybenzoate |
|---|
| Density | 1.428g/cm3 |
|---|---|
| Boiling Point | 672.1ºC at 760 mmHg |
| Molecular Formula | C18H18O10S |
| Molecular Weight | 426.39500 |
| Flash Point | 360.3ºC |
| Exact Mass | 426.06200 |
| PSA | 154.04000 |
| LogP | 2.60180 |
| Index of Refraction | 1.572 |
| InChIKey | PTHZOEFLUWBKIJ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(S(=O)(=O)c2cc(C(=O)OC)c(O)cc2OC)c(OC)cc1O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |