methyl 2-hydroxy-5-(4-hydroxy-3-methoxycarbonyl-5-methyl-phenyl)sulfonyl-3-methyl-benzoate structure
|
Common Name | methyl 2-hydroxy-5-(4-hydroxy-3-methoxycarbonyl-5-methyl-phenyl)sulfonyl-3-methyl-benzoate | ||
|---|---|---|---|---|
| CAS Number | 56923-27-4 | Molecular Weight | 394.39600 | |
| Density | 1.393g/cm3 | Boiling Point | 591.6ºC at 760 mmHg | |
| Molecular Formula | C18H18O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.6ºC | |
| Name | methyl 2-hydroxy-5-(4-hydroxy-3-methoxycarbonyl-5-methylphenyl)sulfonyl-3-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.393g/cm3 |
|---|---|
| Boiling Point | 591.6ºC at 760 mmHg |
| Molecular Formula | C18H18O8S |
| Molecular Weight | 394.39600 |
| Flash Point | 311.6ºC |
| Exact Mass | 394.07200 |
| PSA | 135.58000 |
| LogP | 3.20140 |
| Index of Refraction | 1.584 |
| InChIKey | MPVLWHAACUEDNV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(S(=O)(=O)c2cc(C)c(O)c(C(=O)OC)c2)cc(C)c1O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| methyl 2-hydroxy-5-(4-hydroxy-3-methoxycarbonyl-5-methyl-phenyl)sulfonyl-3-methyl-benzoate |