Ethanediamide,N1-[2-(aminocarbonyl)phenyl]- structure
|
Common Name | Ethanediamide,N1-[2-(aminocarbonyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 56934-61-3 | Molecular Weight | 207.18600 | |
| Density | 1.458g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-Phenyl-N-phenethyl-hydrazin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.458g/cm3 |
|---|---|
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.18600 |
| Exact Mass | 207.06400 |
| PSA | 115.28000 |
| LogP | 0.68290 |
| Index of Refraction | 1.669 |
| InChIKey | GTASZHYMEWRNFN-UHFFFAOYSA-N |
| SMILES | NC(=O)C(=O)Nc1ccccc1C(N)=O |
|
~%
Ethanediamide,N... CAS#:56934-61-3 |
| Literature: Sellstedt; Guinosso; Begany; Bell; Rosenthale Journal of Medicinal Chemistry, 1975 , vol. 18, # 9 p. 926 - 933 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-Aminooxalyl-anthranilsaeure-amid |
| N-phenethyl-N-phenyl-hydrazine |
| N-aminooxalyl-anthranilic acid amide |
| N-Phenaethyl-N-phenyl-hydrazin |
| N-amino-N-phenethylaniline |
| N-Oxamoyl-anthranilamid |
| N-Oxamoyl-anthranilsaeure-amid |