1-ethyl-5-hydroxy-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one structure
|
Common Name | 1-ethyl-5-hydroxy-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 56948-74-4 | Molecular Weight | 273.25100 | |
| Density | 1.32g/cm3 | Boiling Point | 371.1ºC at 760 mmHg | |
| Molecular Formula | C13H14F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.3ºC | |
| Name | 1-ethyl-5-hydroxy-5-[3-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 371.1ºC at 760 mmHg |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25100 |
| Flash Point | 178.3ºC |
| Exact Mass | 273.09800 |
| PSA | 40.54000 |
| LogP | 2.43070 |
| Index of Refraction | 1.514 |
| InChIKey | ZZYOSARVKQOTEO-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)CCC1(O)c1cccc(C(F)(F)F)c1 |
| HS Code | 2933790090 |
|---|
|
~%
1-ethyl-5-hydro... CAS#:56948-74-4 |
| Literature: Houlihan, William J.; Gogerty, John H.; Ryan, Eileen A.; Schmitt, Gemma Journal of Medicinal Chemistry, 1985 , vol. 28, # 1 p. 28 - 31 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |