1-(cyclohexyl-methyl-amino)-3,3-dimethyl-butan-2-one structure
|
Common Name | 1-(cyclohexyl-methyl-amino)-3,3-dimethyl-butan-2-one | ||
|---|---|---|---|---|
| CAS Number | 56957-52-9 | Molecular Weight | 211.34400 | |
| Density | 0.92g/cm3 | Boiling Point | 287.1ºC at 760 mmHg | |
| Molecular Formula | C13H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.6ºC | |
| Name | 1-[cyclohexyl(methyl)amino]-3,3-dimethylbutan-2-one |
|---|
| Density | 0.92g/cm3 |
|---|---|
| Boiling Point | 287.1ºC at 760 mmHg |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.34400 |
| Flash Point | 87.6ºC |
| Exact Mass | 211.19400 |
| PSA | 20.31000 |
| LogP | 2.86610 |
| Index of Refraction | 1.471 |
| InChIKey | ZPGPWPJFCYFMLL-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)C(C)(C)C)C1CCCCC1 |
|
~%
1-(cyclohexyl-m... CAS#:56957-52-9 |
| Literature: Gaset,A. et al. Spectrochimica Acta, Part A: Molecular and Biomolecular Spectroscopy, 1975 , vol. 31, p. 727 - 740 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |