2-AMINO-3-CHLORO-5-NITRO-6-PICOLINE structure
|
Common Name | 2-AMINO-3-CHLORO-5-NITRO-6-PICOLINE | ||
|---|---|---|---|---|
| CAS Number | 56960-81-7 | Molecular Weight | 187.58400 | |
| Density | 1.501g/cm3 | Boiling Point | 313.197ºC at 760 mmHg | |
| Molecular Formula | C6H6ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.217ºC | |
| Name | 3-chloro-6-methyl-5-nitropyridin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.501g/cm3 |
|---|---|
| Boiling Point | 313.197ºC at 760 mmHg |
| Molecular Formula | C6H6ClN3O2 |
| Molecular Weight | 187.58400 |
| Flash Point | 143.217ºC |
| Exact Mass | 187.01500 |
| PSA | 84.73000 |
| LogP | 2.63820 |
| Index of Refraction | 1.637 |
| InChIKey | JUXCWOVRMIHTRK-UHFFFAOYSA-N |
| SMILES | Cc1nc(N)c(Cl)cc1[N+](=O)[O-] |
|
~%
2-AMINO-3-CHLOR... CAS#:56960-81-7 |
| Literature: Parker; Shive Journal of the American Chemical Society, 1947 , vol. 69, p. 63,66 |
|
~%
2-AMINO-3-CHLOR... CAS#:56960-81-7 |
| Literature: Parker; Shive Journal of the American Chemical Society, 1947 , vol. 69, p. 63,66 |
|
~%
2-AMINO-3-CHLOR... CAS#:56960-81-7 |
| Literature: Parker; Shive Journal of the American Chemical Society, 1947 , vol. 69, p. 63,66 |
| 3-chloro-6-methyl-5-nitro-[2]pyridylamine |
| 2-Amino-3-chlor-6-methyl-5-nitro-pyridin |
| 3-chloro-6-methyl-5-nitro-2-pyridinamine |
| 3-chloranyl-6-methyl-5-nitro-pyridin-2-amine |
| 3-Chlor-6-methyl-5-nitro-[2]pyridylamin |
| 2-Amino-3-chloro-5-nitro-6-picoline |