1-Chloro-6-nitronaphthalene structure
|
Common Name | 1-Chloro-6-nitronaphthalene | ||
|---|---|---|---|---|
| CAS Number | 56961-36-5 | Molecular Weight | 207.613 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 354.0±15.0 °C at 760 mmHg | |
| Molecular Formula | C10H6ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.9±20.4 °C | |
| Name | 1-Chloro-6-nitronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.0±15.0 °C at 760 mmHg |
| Molecular Formula | C10H6ClNO2 |
| Molecular Weight | 207.613 |
| Flash Point | 167.9±20.4 °C |
| Exact Mass | 207.008713 |
| PSA | 45.82000 |
| LogP | 3.77 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.678 |
| InChIKey | ZROFLSNLBFQHLM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(Cl)cccc2c1 |
|
~%
1-Chloro-6-nitr... CAS#:56961-36-5 |
| Literature: Hodgson; Turner Journal of the Chemical Society, 1943 , p. 391,392 |
|
~6%
1-Chloro-6-nitr... CAS#:56961-36-5
Detail
|
| Literature: Attia, Mamdouh; Gore, Peter H.; Morris, Donald F. C. Journal of Chemical Research, Miniprint, 1987 , # 5 p. 1332 - 1343 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Naphthalene, 1-chloro-6-nitro- |
| 1-Chlor-6-nitro-naphthalin |
| 1-Chloro-6-nitronaphthalene |
| 1-chloro-6-nitro-naphthalene |
| Naphthalene,1-chloro-6-nitro |