CID 119097737
Modify Date: 2026-08-03 15:42:43
CID 119097737 structure
|
Common Name | CID 119097737 | ||
|---|---|---|---|---|
| CAS Number | 56962-02-8 | Molecular Weight | 188.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 119097737 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H5ClN2O3 |
|---|---|
| Molecular Weight | 188.57 |
| InChIKey | SEBARHFJNGWOFU-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)c(O)c([N+](=O)[O-])c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of CID 119097737? |
| A: SMILES notation of CID 119097737 is Nc1cc(Cl)c(O)c([N+](=O)[O-])c1. |
| Q: What is the Chinese name of 56962-02-8? |
| A: Chinese name of 56962-02-8 is 56962-02-8. |
| Q: What is the molecular weight of CID 119097737? |
| A: Molecular weight of CID 119097737 is 188.57. |
| Q: What is the molecular formula of CID 119097737? |
| A: Molecular formula of CID 119097737 is C6H5ClN2O3. |
| Q: What is the English name of CID 119097737? |
| A: The English name of CID 119097737 is CID 119097737. |
| Q: What is the InChIKey of CID 119097737? |
| A: InChIKey of CID 119097737 is SEBARHFJNGWOFU-UHFFFAOYSA-N. |
| Q: What is the CAS number of CID 119097737? |
| A: CAS number of CID 119097737 is 56962-02-8. |