5-Chloro-2-(3-methylphenoxy)aniline structure
|
Common Name | 5-Chloro-2-(3-methylphenoxy)aniline | ||
|---|---|---|---|---|
| CAS Number | 56966-51-9 | Molecular Weight | 233.69300 | |
| Density | 1.226g/cm3 | Boiling Point | 339ºC at 760mmHg | |
| Molecular Formula | C13H12ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.8ºC | |
| Name | 5-Chloro-2-(3-methylphenoxy)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 339ºC at 760mmHg |
| Molecular Formula | C13H12ClNO |
| Molecular Weight | 233.69300 |
| Flash Point | 158.8ºC |
| Exact Mass | 233.06100 |
| PSA | 35.25000 |
| LogP | 4.60410 |
| Index of Refraction | 1.616 |
| InChIKey | KBUUENZGTGZADQ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(Oc2ccc(Cl)cc2N)c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Chlor-2-amino-phenol-m-tolylaether |
| 5-Chlor-2-m-tolyloxy-anilin |
| 5-chloro-2-m-tolyloxy-aniline |
| HMS1752F12 |
| 4'-Chlor-2'-amino-3-methyl-diphenylaether |
| HMS2637A15 |