3-methyl-2-phenylmethoxy-butanoic acid
3-methyl-2-phenylmethoxy-butanoic acid structure
|
Common Name | 3-methyl-2-phenylmethoxy-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 56972-71-5 | Molecular Weight | 208.25400 | |
| Density | 1.095g/cm3 | Boiling Point | 346.5ºC at 760mmHg | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.8ºC | |
Summary: 3-Methyl-2-phenylmethoxybutanoic acid (Chinese name: 3-甲基-2-苯甲氧基丁酸，CAS number: 56972-71-5), molecular formula C12H16O3, molecular weight 208.25400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-methyl-2-phenylmethoxybutanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.095g/cm3 |
|---|---|
| Boiling Point | 346.5ºC at 760mmHg |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.25400 |
| Flash Point | 130.8ºC |
| Exact Mass | 208.11000 |
| PSA | 46.53000 |
| LogP | 2.31240 |
| InChIKey | NUKFKPKZNHUBOR-UHFFFAOYSA-N |
| SMILES | CC(C)C(OCc1ccccc1)C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-methyl-2-phen... CAS#:56972-71-5 |
| Literature: Yakura, Takayuki; Tanaka, Takeshi; Ikeda, Masazumi; Uenishi, Jun'ichi Chemical and Pharmaceutical Bulletin, 2003 , vol. 51, # 4 p. 471 - 473 |
|
~%
3-methyl-2-phen... CAS#:56972-71-5 |
| Literature: Groger; Syring; Johne Pharmazie, 1975 , vol. 30, # 7 p. 440 - 443 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-benzyloxy-3-methylbutanoic acid |
| 3-methyl-2-phenylmethoxy-butanoic acid |
| (S)-2-(benzyloxy)-3-methylbutanoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-methyl-2-phenylmethoxybutanoic acid? |
| A: CAS number of 3-methyl-2-phenylmethoxybutanoic acid is 56972-71-5. |
| Q: What is the InChIKey of 3-methyl-2-phenylmethoxybutanoic acid? |
| A: InChIKey of 3-methyl-2-phenylmethoxybutanoic acid is NUKFKPKZNHUBOR-UHFFFAOYSA-N. |
| Q: What is the English name of 3-methyl-2-phenylmethoxybutanoic acid? |
| A: The English name of 3-methyl-2-phenylmethoxybutanoic acid is 3-methyl-2-phenylmethoxybutanoic acid. |
| Q: What is the LogP of 3-methyl-2-phenylmethoxybutanoic acid? |
| A: LogP of 3-methyl-2-phenylmethoxybutanoic acid is 2.31240. |
| Q: What English synonyms does 3-methyl-2-phenylmethoxybutanoic acid have? |
| A: English synonyms of 3-methyl-2-phenylmethoxybutanoic acid: 2-benzyloxy-3-methylbutanoic acid, 3-methyl-2-phenylmethoxy-butanoic acid, (S)-2-(benzyloxy)-3-methylbutanoic acid. |
| Q: What is the molecular weight of 3-methyl-2-phenylmethoxybutanoic acid? |
| A: Molecular weight of 3-methyl-2-phenylmethoxybutanoic acid is 208.25400. |
| Q: What is the SMILES notation of 3-methyl-2-phenylmethoxybutanoic acid? |
| A: SMILES notation of 3-methyl-2-phenylmethoxybutanoic acid is CC(C)C(OCc1ccccc1)C(=O)O. |
| Q: What is the polar surface area (PSA) of 3-methyl-2-phenylmethoxybutanoic acid? |
| A: Polar surface area (PSA) of 3-methyl-2-phenylmethoxybutanoic acid is 46.53000. |
| Q: What is the molecular formula of 3-methyl-2-phenylmethoxybutanoic acid? |
| A: Molecular formula of 3-methyl-2-phenylmethoxybutanoic acid is C12H16O3. |
| Q: What are the upstream materials of 3-methyl-2-phenylmethoxybutanoic acid? |
| A: Related upstream materials(CAS) of 3-methyl-2-phenylmethoxybutanoic acid: 110351-27-4;609-12-1;20194-18-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |