2-(diethylamino)-N-(3-ethylphenyl)acetamide structure
|
Common Name | 2-(diethylamino)-N-(3-ethylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 56974-53-9 | Molecular Weight | 234.33700 | |
| Density | 1.025g/cm3 | Boiling Point | 379.7ºC at 760 mmHg | |
| Molecular Formula | C14H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.4ºC | |
| Name | 2-(diethylamino)-N-(3-ethylphenyl)acetamide |
|---|
| Density | 1.025g/cm3 |
|---|---|
| Boiling Point | 379.7ºC at 760 mmHg |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.33700 |
| Flash Point | 183.4ºC |
| Exact Mass | 234.17300 |
| PSA | 35.83000 |
| LogP | 3.17880 |
| Index of Refraction | 1.545 |
| InChIKey | DUFKYHFOWFLCET-UHFFFAOYSA-N |
| SMILES | CCc1cccc(NC(=O)CN(CC)CC)c1 |
| HS Code | 2924299090 |
|---|
|
~%
2-(diethylamino... CAS#:56974-53-9 |
| Literature: Oelschlaeger Arzneimittel Forschung, 1958 , vol. 8, p. 532,536 |
|
~%
2-(diethylamino... CAS#:56974-53-9 |
| Literature: Oelschlaeger Arzneimittel Forschung, 1958 , vol. 8, p. 532,536 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |