ethyl 4-carbamoyl-3-methyl-5-(9H-xanthene-9-carbonylamino)thiophene-2-carboxylate structure
|
Common Name | ethyl 4-carbamoyl-3-methyl-5-(9H-xanthene-9-carbonylamino)thiophene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5698-18-0 | Molecular Weight | 436.48000 | |
| Density | 1.387g/cm3 | Boiling Point | 605.6ºC at 760 mmHg | |
| Molecular Formula | C23H20N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 320.1ºC | |
| Name | ethyl 4-carbamoyl-3-methyl-5-(9H-xanthene-9-carbonylamino)thiophene-2-carboxylate |
|---|
| Density | 1.387g/cm3 |
|---|---|
| Boiling Point | 605.6ºC at 760 mmHg |
| Molecular Formula | C23H20N2O5S |
| Molecular Weight | 436.48000 |
| Flash Point | 320.1ºC |
| Exact Mass | 436.10900 |
| PSA | 140.44000 |
| LogP | 5.74210 |
| Index of Refraction | 1.671 |
| InChIKey | GRTDOPDVVRZLDF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1sc(NC(=O)C2c3ccccc3Oc3ccccc32)c(C(N)=O)c1C |
| HS Code | 2933990090 |
|---|
|
~%
ethyl 4-carbamo... CAS#:5698-18-0 |
| Literature: Ortho-McNeil Pharmaceutical, Inc. Patent: US6765004 B1, 2004 ; Location in patent: Page column 14; 15 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |