5-methoxy-2-[(4-methoxyphenyl)amino]benzoic acid structure
|
Common Name | 5-methoxy-2-[(4-methoxyphenyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 56980-14-4 | Molecular Weight | 273.28400 | |
| Density | 1.265g/cm3 | Boiling Point | 448.2ºC at 760 mmHg | |
| Molecular Formula | C15H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.9ºC | |
| Name | 5-methoxy-2-(4-methoxyanilino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 448.2ºC at 760 mmHg |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.28400 |
| Flash Point | 224.9ºC |
| Exact Mass | 273.10000 |
| PSA | 67.79000 |
| LogP | 3.21860 |
| Index of Refraction | 1.62 |
| InChIKey | CPUDINMZJMFLMJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2ccc(OC)cc2C(=O)O)cc1 |
| HS Code | 2922509090 |
|---|
|
~73%
5-methoxy-2-[(4... CAS#:56980-14-4 |
| Literature: Orda-Zgadzaj, Marzena; Abraham, Werner Synthesis, 2007 , # 21 art. no. T09407SS, p. 3345 - 3356 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-p-anisidino-5-methoxy-benzoic acid |
| QC-975 |
| 2-p-Anisidino-5-methoxy-benzoesaeure |