2-Butenedioic acid,2-(1-naphthalenylamino)-, 1,4-dimethyl ester structure
|
Common Name | 2-Butenedioic acid,2-(1-naphthalenylamino)-, 1,4-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 56983-64-3 | Molecular Weight | 285.29500 | |
| Density | 1.262g/cm3 | Boiling Point | 450ºC at 760 mmHg | |
| Molecular Formula | C16H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.9ºC | |
| Name | dimethyl (E)-2-(naphthalen-1-ylamino)but-2-enedioate |
|---|
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 450ºC at 760 mmHg |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.29500 |
| Flash Point | 225.9ºC |
| Exact Mass | 285.10000 |
| PSA | 64.63000 |
| LogP | 2.55460 |
| Index of Refraction | 1.629 |
| InChIKey | ZZWPMWHEHQYQTR-GXDHUFHOSA-N |
| SMILES | COC(=O)C=C(Nc1cccc2ccccc12)C(=O)OC |
|
~%
2-Butenedioic a... CAS#:56983-64-3 |
| Literature: Sun, Jing; Wu, Qun; Zhang, Lijuan; Yan, Chaoguo Chinese Journal of Chemistry, 2012 , vol. 30, # 7 p. 1548 - 1554 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |