Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl
Modify Date: 2026-07-06 18:43:08
Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl structure
|
Common Name | Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl | ||
|---|---|---|---|---|
| CAS Number | 57-32-9 | Molecular Weight | 210.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H18N2O2 |
|---|---|
| Molecular Weight | 210.27 |
| InChIKey | LGKMSXAVAQBKPM-UHFFFAOYSA-N |
| SMILES | CCC(C(N)=O)(C(N)=O)C1=CCCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl? |
| A: The English name of Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl is Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl. |
| Q: What is the InChIKey of Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl? |
| A: InChIKey of Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl is LGKMSXAVAQBKPM-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl? |
| A: Molecular weight of Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl is 210.27. |
| Q: What is the Chinese name of 57-32-9? |
| A: Chinese name of 57-32-9 is 57-32-9. |
| Q: What is the CAS number of Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl? |
| A: CAS number of Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl is 57-32-9. |
| Q: What is the molecular formula of Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl? |
| A: Molecular formula of Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl is C11H18N2O2. |
| Q: What is the SMILES notation of Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl? |
| A: SMILES notation of Propanediamide, 2-(1-cyclohexen-1-yl)-2-ethyl is CCC(C(N)=O)(C(N)=O)C1=CCCCC1. |