1-(5-chloro-2-hydroxyphenyl)-3-(2-methoxyphenyl)propane-1,3-dione structure
|
Common Name | 1-(5-chloro-2-hydroxyphenyl)-3-(2-methoxyphenyl)propane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 57006-72-1 | Molecular Weight | 304.72500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(5-chloro-2-hydroxyphenyl)-3-(2-methoxyphenyl)propane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13ClO4 |
|---|---|
| Molecular Weight | 304.72500 |
| Exact Mass | 304.05000 |
| PSA | 63.60000 |
| LogP | 3.50990 |
| InChIKey | KDVFSEXWKXLDJF-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C(=O)CC(=O)c1cc(Cl)ccc1O |
|
~77%
1-(5-chloro-2-h... CAS#:57006-72-1 |
| Literature: Thakar, K. A.; Gill, C. H. Journal of the Indian Chemical Society, 1983 , vol. 60, p. 668 - 670 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2-hydroxy-5-chloro-2'-methoxydibenzoylmethane |