2-(3,4,5-trimethoxyphenyl)-1,3-dithiane structure
|
Common Name | 2-(3,4,5-trimethoxyphenyl)-1,3-dithiane | ||
|---|---|---|---|---|
| CAS Number | 57009-70-8 | Molecular Weight | 286.41000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3,4,5-trimethoxyphenyl)-1,3-dithiane |
|---|
| Molecular Formula | C13H18O3S2 |
|---|---|
| Molecular Weight | 286.41000 |
| Exact Mass | 286.07000 |
| PSA | 78.29000 |
| LogP | 3.58110 |
| InChIKey | QOWQNDBUFBXLMY-UHFFFAOYSA-N |
| SMILES | COc1cc(C2SCCCS2)cc(OC)c1OC |
|
~98%
2-(3,4,5-trimet... CAS#:57009-70-8 |
| Literature: Kumar; Reddy; Singh; Pandey Synthesis, 1993 , # 1 p. 67 - 69 |
|
~91%
2-(3,4,5-trimet... CAS#:57009-70-8 |
| Literature: Jnaneshwara; Barhate; Sudalai; Deshpande; Wakharkar; Gajare; Shingare; Sukumar Journal of the Chemical Society - Perkin Transactions 1, 1998 , # 5 p. 965 - 968 |
| Precursor 3 | |
|---|---|
| DownStream 9 | |