(3-Chlorophenyl)carbamic acid 1-methylethyl ester mixt. with 1,2-dihydro-3,6-pyridazinedione structure
|
Common Name | (3-Chlorophenyl)carbamic acid 1-methylethyl ester mixt. with 1,2-dihydro-3,6-pyridazinedione | ||
|---|---|---|---|---|
| CAS Number | 57017-75-1 | Molecular Weight | 325.75 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-Chlorophenyl)carbamic acid 1-methylethyl ester mixt. with 1,2-dihydro-3,6-pyridazinedione |
|---|
| Molecular Formula | C14H16ClN3O4 |
|---|---|
| Molecular Weight | 325.75 |
| InChIKey | COPDJXMFPVQUPI-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)Nc1cccc(Cl)c1.O=c1ccc(=O)[nH][nH]1 |