2-butylsulfanyl-3-cyclohexylspiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one structure
|
Common Name | 2-butylsulfanyl-3-cyclohexylspiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one | ||
|---|---|---|---|---|
| CAS Number | 5705-11-3 | Molecular Weight | 422.62600 | |
| Density | 1.24g/cm3 | Boiling Point | 581.1ºC at 760 mmHg | |
| Molecular Formula | C26H34N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.2ºC | |
| Name | 2-butylsulfanyl-3-cyclohexylspiro[6H-benzo[h]quinazoline-5,1'-cyclopentane]-4-one |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 581.1ºC at 760 mmHg |
| Molecular Formula | C26H34N2OS |
| Molecular Weight | 422.62600 |
| Flash Point | 305.2ºC |
| Exact Mass | 422.23900 |
| PSA | 60.19000 |
| LogP | 6.67560 |
| Index of Refraction | 1.66 |
| InChIKey | HOUGNDNMDRSVPR-UHFFFAOYSA-N |
| SMILES | CCCCSc1nc2c(c(=O)n1C1CCCCC1)C1(CCCC1)Cc1ccccc1-2 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |