2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-3-cyclohexylspiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one structure
|
Common Name | 2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-3-cyclohexylspiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one | ||
|---|---|---|---|---|
| CAS Number | 5705-13-5 | Molecular Weight | 533.12400 | |
| Density | 1.33g/cm3 | Boiling Point | 702.6ºC at 760 mmHg | |
| Molecular Formula | C31H33ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 378.7ºC | |
| Name | 2-[2-(4-chlorophenyl)-2-oxoethyl]sulfanyl-3-cyclohexylspiro[6H-benzo[h]quinazoline-5,1'-cyclohexane]-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 702.6ºC at 760 mmHg |
| Molecular Formula | C31H33ClN2O2S |
| Molecular Weight | 533.12400 |
| Flash Point | 378.7ºC |
| Exact Mass | 532.19500 |
| PSA | 77.26000 |
| LogP | 7.80190 |
| Index of Refraction | 1.685 |
| InChIKey | WQZICWIGTZOVNT-UHFFFAOYSA-N |
| SMILES | O=C(CSc1nc2c(c(=O)n1C1CCCCC1)C1(CCCCC1)Cc1ccccc1-2)c1ccc(Cl)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N-Benzyl-N-nitroso-p-anisidin |