benzyl 4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate structure
|
Common Name | benzyl 4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5706-17-2 | Molecular Weight | 509.59200 | |
| Density | 1.28g/cm3 | Boiling Point | 685.6ºC at 760mmHg | |
| Molecular Formula | C32H31NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 368.4ºC | |
| Name | benzyl 4-(3-ethoxy-4-hydroxyphenyl)-2-methyl-5-oxo-7-phenyl-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 685.6ºC at 760mmHg |
| Molecular Formula | C32H31NO5 |
| Molecular Weight | 509.59200 |
| Flash Point | 368.4ºC |
| Exact Mass | 509.22000 |
| PSA | 84.86000 |
| LogP | 6.22470 |
| Index of Refraction | 1.651 |
| InChIKey | UOFXXVJASTWENW-UHFFFAOYSA-N |
| SMILES | CCOc1cc(C2C(C(=O)OCc3ccccc3)=C(C)NC3=C2C(=O)CC(c2ccccc2)C3)ccc1O |
| HS Code | 2914700090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |