Carbamodithioic acid, ((4-methylphenyl)sulfonyl)- structure
|
Common Name | Carbamodithioic acid, ((4-methylphenyl)sulfonyl)- | ||
|---|---|---|---|---|
| CAS Number | 5706-65-0 | Molecular Weight | 286.45600 | |
| Density | 1.41g/cm3 | Boiling Point | 373.1ºC at 760 mmHg | |
| Molecular Formula | C8H9KNO2S3+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.4ºC | |
| Name | (4-methylphenyl)sulfonylcarbamodithioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 373.1ºC at 760 mmHg |
| Molecular Formula | C8H9KNO2S3+ |
| Molecular Weight | 286.45600 |
| Flash Point | 179.4ºC |
| Exact Mass | 285.94300 |
| PSA | 125.44000 |
| LogP | 2.95970 |
| Index of Refraction | 1.643 |
| InChIKey | SZIJCAQOUZBADT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC(=S)S)cc1 |
|
~72%
Carbamodithioic... CAS#:5706-65-0 |
| Literature: Howes, P.D.; Payne, J.J.; Pianka, M. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1038 - 1044 |
| 4-CH3C6H4SO2N=CS2K2 |
| Carbamodithioic acid,[(4-methylphenyl)sulfonyl] |
| Dikalium-N-(p-toluolsulfonyl)-imidodithiocarbonat |
| dipotassium p-tolylsulfonyldithiocarbimate |
| Imidocarbonic acid der. |
| dipotassium p-tolylsulfonyl dithiocarbamate |