Isamoxole structure
|
Common Name | Isamoxole | ||
|---|---|---|---|---|
| CAS Number | 57067-46-6 | Molecular Weight | 224.29900 | |
| Density | 1.037g/cm3 | Boiling Point | 296.1ºC at 760 mmHg | |
| Molecular Formula | C12H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.9ºC | |
| Name | N-butyl-2-methyl-N-(4-methyl-1,3-oxazol-2-yl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.037g/cm3 |
|---|---|
| Boiling Point | 296.1ºC at 760 mmHg |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.29900 |
| Flash Point | 132.9ºC |
| Exact Mass | 224.15200 |
| PSA | 46.34000 |
| LogP | 2.77210 |
| Index of Refraction | 1.499 |
| InChIKey | VMBNXRJYPJRJIU-UHFFFAOYSA-N |
| SMILES | CCCCN(C(=O)C(C)C)c1nc(C)co1 |
|
~80%
Isamoxole CAS#:57067-46-6 |
| Literature: Lilly Industries Limited Patent: US4143047 A1, 1979 ; |
|
~%
Isamoxole CAS#:57067-46-6 |
| Literature: Ross; Harrison; Jolley; Neville; Todd; Verge; Dawson; Sweatman Journal of Medicinal Chemistry, 1979 , vol. 22, # 4 p. 412 - 417 |
|
~%
Isamoxole CAS#:57067-46-6 |
| Literature: Ross; Harrison; Jolley; Neville; Todd; Verge; Dawson; Sweatman Journal of Medicinal Chemistry, 1979 , vol. 22, # 4 p. 412 - 417 |
| 2-(N-n-Butyl-2-methylpropanamido)-4-methyloxazole |
| N-butyl-N-(4-methyl-oxazol-2-yl)-isobutyramide |
| ISAMOXOLE |
| Isamoxolum |
| Isamoxolum [INN-Latin] |
| Propanamide,N-butyl-2-methyl-N-(4-methyl-2-oxazolyl) |
| Isamoxol [INN-Spanish] |
| Isamoxole (USAN/INN) |
| UNII-24QIB5VSGX |
| Isamoxol |