1-(4-chlorophenyl)-3-(3-methylphenyl)prop-2-en-1-one structure
|
Common Name | 1-(4-chlorophenyl)-3-(3-methylphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 57076-82-1 | Molecular Weight | 256.72700 | |
| Density | 1.177g/cm3 | Boiling Point | 399.9ºC at 760mmHg | |
| Molecular Formula | C16H13ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.4ºC | |
| Name | 1-(4-chlorophenyl)-3-(3-methylphenyl)prop-2-en-1-one |
|---|
| Density | 1.177g/cm3 |
|---|---|
| Boiling Point | 399.9ºC at 760mmHg |
| Molecular Formula | C16H13ClO |
| Molecular Weight | 256.72700 |
| Flash Point | 226.4ºC |
| Exact Mass | 256.06500 |
| PSA | 17.07000 |
| LogP | 4.54450 |
| Index of Refraction | 1.622 |
| InChIKey | GTYAXENHVWQUET-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C=CC(=O)c2ccc(Cl)cc2)c1 |
|
~%
1-(4-chlorophen... CAS#:57076-82-1 |
| Literature: Sondu, S.; Sethuram, B; Rao, T. Navaneeth Indian Journal of Chemistry, Section A: Inorganic, Physical, Theoretical and Analytical, 1990 , vol. 29, # 1 p. 67 - 69 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |