N-Formyl-3-hydroxy-L-tyrosine methyl ester
Modify Date: 2025-09-18 11:38:06
N-Formyl-3-hydroxy-L-tyrosine methyl ester structure
|
Common Name | N-Formyl-3-hydroxy-L-tyrosine methyl ester | ||
|---|---|---|---|---|
| CAS Number | 57085-16-2 | Molecular Weight | 239.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-Formyl-3-hydroxy-L-tyrosine methyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13NO5 |
|---|---|
| Molecular Weight | 239.22 |
| InChIKey | ULJMFSNGWRERPC-QMMMGPOBSA-N |
| SMILES | COC(=O)C(Cc1ccc(O)c(O)c1)NC=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-Formyl-3-hydroxy-L-tyrosine methyl ester? |
| A: Molecular formula of N-Formyl-3-hydroxy-L-tyrosine methyl ester is C11H13NO5. |
| Q: What is the CAS number of N-Formyl-3-hydroxy-L-tyrosine methyl ester? |
| A: CAS number of N-Formyl-3-hydroxy-L-tyrosine methyl ester is 57085-16-2. |
| Q: What is the molecular weight of N-Formyl-3-hydroxy-L-tyrosine methyl ester? |
| A: Molecular weight of N-Formyl-3-hydroxy-L-tyrosine methyl ester is 239.22. |
| Q: What is the English name of N-Formyl-3-hydroxy-L-tyrosine methyl ester? |
| A: The English name of N-Formyl-3-hydroxy-L-tyrosine methyl ester is N-Formyl-3-hydroxy-L-tyrosine methyl ester. |
| Q: What is the Chinese name of 57085-16-2? |
| A: Chinese name of 57085-16-2 is 57085-16-2. |
| Q: What is the SMILES notation of N-Formyl-3-hydroxy-L-tyrosine methyl ester? |
| A: SMILES notation of N-Formyl-3-hydroxy-L-tyrosine methyl ester is COC(=O)C(Cc1ccc(O)c(O)c1)NC=O. |
| Q: What is the InChIKey of N-Formyl-3-hydroxy-L-tyrosine methyl ester? |
| A: InChIKey of N-Formyl-3-hydroxy-L-tyrosine methyl ester is ULJMFSNGWRERPC-QMMMGPOBSA-N. |